C22H24N4O3S — CID 3288284
N-[5-[2-(2,4-dimethylanilino)-2-oxoethyl]-3-ethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]benzamide (PubChem CID 3288284) has the molecular formula C22H24N4O3S and a molecular weight of 424.53 g/mol. Its IUPAC name is N-[5-[2-(2,4-dimethylanilino)-2-oxoethyl]-3-ethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]benzamide.
| Compound Name | N-[5-[2-(2,4-dimethylanilino)-2-oxoethyl]-3-ethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]benzamide |
|---|---|
| PubChem CID | 3288284 |
| Molecular Formula | C22H24N4O3S |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | N-[5-[2-(2,4-dimethylanilino)-2-oxoethyl]-3-ethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]benzamide |
| SMILES | CCN1C(=O)C(CC(=O)Nc2ccc(C)cc2C)N(NC(=O)c2ccccc2)C1=S |
| InChI | InChI=1S/C22H24N4O3S/c1-4-25-21(29)18(13-19(27)23-17-11-10-14(2)12-15(17)3)26(22(25)30)24-20(28)16-8-6-5-7-9-16/h5-12,18H,4,13H2,1-3H3,(H,23,27)(H,24,28) |
| InChIKey | OAMJNRXCDZYVFY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|