C23H26N4O6S — CID 19585940
N-[3-ethyl-5-[2-(4-methoxyanilino)-2-oxoethyl]-4-oxo-2-sulfanylideneimidazolidin-1-yl]-3,5-dimethoxybenzamide (PubChem CID 19585940) has the molecular formula C23H26N4O6S and a molecular weight of 486.55 g/mol. Its IUPAC name is N-[3-ethyl-5-[2-(4-methoxyanilino)-2-oxoethyl]-4-oxo-2-sulfanylideneimidazolidin-1-yl]-3,5-dimethoxybenzamide.
| Compound Name | N-[3-ethyl-5-[2-(4-methoxyanilino)-2-oxoethyl]-4-oxo-2-sulfanylideneimidazolidin-1-yl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 19585940 |
| Molecular Formula | C23H26N4O6S |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | N-[3-ethyl-5-[2-(4-methoxyanilino)-2-oxoethyl]-4-oxo-2-sulfanylideneimidazolidin-1-yl]-3,5-dimethoxybenzamide |
| SMILES | CCN1C(=O)C(CC(=O)Nc2ccc(OC)cc2)N(NC(=O)c2cc(OC)cc(OC)c2)C1=S |
| InChI | InChI=1S/C23H26N4O6S/c1-5-26-22(30)19(13-20(28)24-15-6-8-16(31-2)9-7-15)27(23(26)34)25-21(29)14-10-17(32-3)12-18(11-14)33-4/h6-12,19H,5,13H2,1-4H3,(H,24,28)(H,25,29) |
| InChIKey | VRVGLWAHDJJSSE-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 109.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|