C21H21BrN4O4S — CID 3343477
4-bromo-N-[3-ethyl-5-[2-(3-methoxyanilino)-2-oxoethyl]-4-oxo-2-sulfanylideneimidazolidin-1-yl]benzamide (PubChem CID 3343477) has the molecular formula C21H21BrN4O4S and a molecular weight of 505.39 g/mol. Its IUPAC name is 4-bromo-N-[3-ethyl-5-[2-(3-methoxyanilino)-2-oxoethyl]-4-oxo-2-sulfanylideneimidazolidin-1-yl]benzamide.
| Compound Name | 4-bromo-N-[3-ethyl-5-[2-(3-methoxyanilino)-2-oxoethyl]-4-oxo-2-sulfanylideneimidazolidin-1-yl]benzamide |
|---|---|
| PubChem CID | 3343477 |
| Molecular Formula | C21H21BrN4O4S |
| Molecular Weight | 505.39 g/mol |
| Exact Mass | 504.05 |
| IUPAC Name | 4-bromo-N-[3-ethyl-5-[2-(3-methoxyanilino)-2-oxoethyl]-4-oxo-2-sulfanylideneimidazolidin-1-yl]benzamide |
| SMILES | CCN1C(=O)C(CC(=O)Nc2cccc(OC)c2)N(NC(=O)c2ccc(Br)cc2)C1=S |
| InChI | InChI=1S/C21H21BrN4O4S/c1-3-25-20(29)17(12-18(27)23-15-5-4-6-16(11-15)30-2)26(21(25)31)24-19(28)13-7-9-14(22)10-8-13/h4-11,17H,3,12H2,1-2H3,(H,23,27)(H,24,28) |
| InChIKey | VRNYCIKDEOHENK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|