C20H18BrFN4O3S — CID 1206399
4-bromo-N-[(5S)-3-ethyl-5-[2-(2-fluoroanilino)-2-oxoethyl]-4-oxo-2-sulfanylideneimidazolidin-1-yl]benzamide (PubChem CID 1206399) has the molecular formula C20H18BrFN4O3S and a molecular weight of 493.36 g/mol. Its IUPAC name is 4-bromo-N-[(5S)-3-ethyl-5-[2-(2-fluoroanilino)-2-oxoethyl]-4-oxo-2-sulfanylideneimidazolidin-1-yl]benzamide.
| Compound Name | 4-bromo-N-[(5S)-3-ethyl-5-[2-(2-fluoroanilino)-2-oxoethyl]-4-oxo-2-sulfanylideneimidazolidin-1-yl]benzamide |
|---|---|
| PubChem CID | 1206399 |
| Molecular Formula | C20H18BrFN4O3S |
| Molecular Weight | 493.36 g/mol |
| Exact Mass | 492.03 |
| IUPAC Name | 4-bromo-N-[(5S)-3-ethyl-5-[2-(2-fluoroanilino)-2-oxoethyl]-4-oxo-2-sulfanylideneimidazolidin-1-yl]benzamide |
| SMILES | CCN1C(=O)[C@H](CC(=O)Nc2ccccc2F)N(NC(=O)c2ccc(Br)cc2)C1=S |
| InChI | InChI=1S/C20H18BrFN4O3S/c1-2-25-19(29)16(11-17(27)23-15-6-4-3-5-14(15)22)26(20(25)30)24-18(28)12-7-9-13(21)10-8-12/h3-10,16H,2,11H2,1H3,(H,23,27)(H,24,28)/t16-/m0/s1 |
| InChIKey | CTLVSUMRHIWIIS-INIZCTEOSA-N |
| XLogP | 3.08 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|