C20H18BrClN4O3S — CID 5235238
4-bromo-N-[3-(4-chlorophenyl)-5-[2-(ethylamino)-2-oxoethyl]-4-oxo-2-sulfanylideneimidazolidin-1-yl]benzamide (PubChem CID 5235238) has the molecular formula C20H18BrClN4O3S and a molecular weight of 509.81 g/mol. Its IUPAC name is 4-bromo-N-[3-(4-chlorophenyl)-5-[2-(ethylamino)-2-oxoethyl]-4-oxo-2-sulfanylideneimidazolidin-1-yl]benzamide.
| Compound Name | 4-bromo-N-[3-(4-chlorophenyl)-5-[2-(ethylamino)-2-oxoethyl]-4-oxo-2-sulfanylideneimidazolidin-1-yl]benzamide |
|---|---|
| PubChem CID | 5235238 |
| Molecular Formula | C20H18BrClN4O3S |
| Molecular Weight | 509.81 g/mol |
| Exact Mass | 508.00 |
| IUPAC Name | 4-bromo-N-[3-(4-chlorophenyl)-5-[2-(ethylamino)-2-oxoethyl]-4-oxo-2-sulfanylideneimidazolidin-1-yl]benzamide |
| SMILES | CCNC(=O)CC1C(=O)N(c2ccc(Cl)cc2)C(=S)N1NC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H18BrClN4O3S/c1-2-23-17(27)11-16-19(29)25(15-9-7-14(22)8-10-15)20(30)26(16)24-18(28)12-3-5-13(21)6-4-12/h3-10,16H,2,11H2,1H3,(H,23,27)(H,24,28) |
| InChIKey | KSVCLUCJVNIRIX-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.81 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|