C27H25ClN4O4S — CID 4116473
4-chloro-N-[4-oxo-5-[2-oxo-2-(4-propoxyanilino)ethyl]-3-phenyl-2-sulfanylideneimidazolidin-1-yl]benzamide (PubChem CID 4116473) has the molecular formula C27H25ClN4O4S and a molecular weight of 537.04 g/mol. Its IUPAC name is 4-chloro-N-[4-oxo-5-[2-oxo-2-(4-propoxyanilino)ethyl]-3-phenyl-2-sulfanylideneimidazolidin-1-yl]benzamide.
| Compound Name | 4-chloro-N-[4-oxo-5-[2-oxo-2-(4-propoxyanilino)ethyl]-3-phenyl-2-sulfanylideneimidazolidin-1-yl]benzamide |
|---|---|
| PubChem CID | 4116473 |
| Molecular Formula | C27H25ClN4O4S |
| Molecular Weight | 537.04 g/mol |
| Exact Mass | 536.13 |
| IUPAC Name | 4-chloro-N-[4-oxo-5-[2-oxo-2-(4-propoxyanilino)ethyl]-3-phenyl-2-sulfanylideneimidazolidin-1-yl]benzamide |
| SMILES | CCCOc1ccc(NC(=O)CC2C(=O)N(c3ccccc3)C(=S)N2NC(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C27H25ClN4O4S/c1-2-16-36-22-14-12-20(13-15-22)29-24(33)17-23-26(35)31(21-6-4-3-5-7-21)27(37)32(23)30-25(34)18-8-10-19(28)11-9-18/h3-15,23H,2,16-17H2,1H3,(H,29,33)(H,30,34) |
| InChIKey | WQDCSOAKDNRCOX-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.04 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|