C25H20Cl2N4O4S — CID 4247107
N-[5-[2-(3,5-dichloroanilino)-2-oxoethyl]-4-oxo-3-phenyl-2-sulfanylideneimidazolidin-1-yl]-4-methoxybenzamide (PubChem CID 4247107) has the molecular formula C25H20Cl2N4O4S and a molecular weight of 543.43 g/mol. Its IUPAC name is N-[5-[2-(3,5-dichloroanilino)-2-oxoethyl]-4-oxo-3-phenyl-2-sulfanylideneimidazolidin-1-yl]-4-methoxybenzamide.
| Compound Name | N-[5-[2-(3,5-dichloroanilino)-2-oxoethyl]-4-oxo-3-phenyl-2-sulfanylideneimidazolidin-1-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 4247107 |
| Molecular Formula | C25H20Cl2N4O4S |
| Molecular Weight | 543.43 g/mol |
| Exact Mass | 542.06 |
| IUPAC Name | N-[5-[2-(3,5-dichloroanilino)-2-oxoethyl]-4-oxo-3-phenyl-2-sulfanylideneimidazolidin-1-yl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NN2C(=S)N(c3ccccc3)C(=O)C2CC(=O)Nc2cc(Cl)cc(Cl)c2)cc1 |
| InChI | InChI=1S/C25H20Cl2N4O4S/c1-35-20-9-7-15(8-10-20)23(33)29-31-21(14-22(32)28-18-12-16(26)11-17(27)13-18)24(34)30(25(31)36)19-5-3-2-4-6-19/h2-13,21H,14H2,1H3,(H,28,32)(H,29,33) |
| InChIKey | XYKSOMDNVBKLPC-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.43 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|