C27H24Cl2N4O4S — CID 4577828
4-chloro-N-[3-(4-chlorophenyl)-4-oxo-5-[2-oxo-2-(4-propoxyanilino)ethyl]-2-sulfanylideneimidazolidin-1-yl]benzamide (PubChem CID 4577828) has the molecular formula C27H24Cl2N4O4S and a molecular weight of 571.49 g/mol. Its IUPAC name is 4-chloro-N-[3-(4-chlorophenyl)-4-oxo-5-[2-oxo-2-(4-propoxyanilino)ethyl]-2-sulfanylideneimidazolidin-1-yl]benzamide.
| Compound Name | 4-chloro-N-[3-(4-chlorophenyl)-4-oxo-5-[2-oxo-2-(4-propoxyanilino)ethyl]-2-sulfanylideneimidazolidin-1-yl]benzamide |
|---|---|
| PubChem CID | 4577828 |
| Molecular Formula | C27H24Cl2N4O4S |
| Molecular Weight | 571.49 g/mol |
| Exact Mass | 570.09 |
| IUPAC Name | 4-chloro-N-[3-(4-chlorophenyl)-4-oxo-5-[2-oxo-2-(4-propoxyanilino)ethyl]-2-sulfanylideneimidazolidin-1-yl]benzamide |
| SMILES | CCCOc1ccc(NC(=O)CC2C(=O)N(c3ccc(Cl)cc3)C(=S)N2NC(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C27H24Cl2N4O4S/c1-2-15-37-22-13-9-20(10-14-22)30-24(34)16-23-26(36)32(21-11-7-19(29)8-12-21)27(38)33(23)31-25(35)17-3-5-18(28)6-4-17/h3-14,23H,2,15-16H2,1H3,(H,30,34)(H,31,35) |
| InChIKey | HMEDJFTWNQHFNW-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.49 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|