C21H19ClN4O5S — CID 3263367
methyl 4-[[2-[3-[(4-chlorobenzoyl)amino]-1-methyl-5-oxo-2-sulfanylideneimidazolidin-4-yl]acetyl]amino]benzoate (PubChem CID 3263367) has the molecular formula C21H19ClN4O5S and a molecular weight of 474.93 g/mol. Its IUPAC name is methyl 4-[[2-[3-[(4-chlorobenzoyl)amino]-1-methyl-5-oxo-2-sulfanylideneimidazolidin-4-yl]acetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-[3-[(4-chlorobenzoyl)amino]-1-methyl-5-oxo-2-sulfanylideneimidazolidin-4-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 3263367 |
| Molecular Formula | C21H19ClN4O5S |
| Molecular Weight | 474.93 g/mol |
| Exact Mass | 474.08 |
| IUPAC Name | methyl 4-[[2-[3-[(4-chlorobenzoyl)amino]-1-methyl-5-oxo-2-sulfanylideneimidazolidin-4-yl]acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)CC2C(=O)N(C)C(=S)N2NC(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H19ClN4O5S/c1-25-19(29)16(11-17(27)23-15-9-5-13(6-10-15)20(30)31-2)26(21(25)32)24-18(28)12-3-7-14(22)8-4-12/h3-10,16H,11H2,1-2H3,(H,23,27)(H,24,28) |
| InChIKey | QUTQQFRMXXRBBC-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.93 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|