C19H15Cl2FN4O3S — CID 19585042
2,4-dichloro-N-[5-[2-(4-fluoroanilino)-2-oxoethyl]-3-methyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]benzamide (PubChem CID 19585042) has the molecular formula C19H15Cl2FN4O3S and a molecular weight of 469.33 g/mol. Its IUPAC name is 2,4-dichloro-N-[5-[2-(4-fluoroanilino)-2-oxoethyl]-3-methyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[5-[2-(4-fluoroanilino)-2-oxoethyl]-3-methyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]benzamide |
|---|---|
| PubChem CID | 19585042 |
| Molecular Formula | C19H15Cl2FN4O3S |
| Molecular Weight | 469.33 g/mol |
| Exact Mass | 468.02 |
| IUPAC Name | 2,4-dichloro-N-[5-[2-(4-fluoroanilino)-2-oxoethyl]-3-methyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]benzamide |
| SMILES | CN1C(=O)C(CC(=O)Nc2ccc(F)cc2)N(NC(=O)c2ccc(Cl)cc2Cl)C1=S |
| InChI | InChI=1S/C19H15Cl2FN4O3S/c1-25-18(29)15(9-16(27)23-12-5-3-11(22)4-6-12)26(19(25)30)24-17(28)13-7-2-10(20)8-14(13)21/h2-8,15H,9H2,1H3,(H,23,27)(H,24,28) |
| InChIKey | JAYFSTMVWURMNZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.33 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|