C20H18Cl2N4O3S — CID 19584955
N-[3-benzyl-5-[2-(methylamino)-2-oxoethyl]-4-oxo-2-sulfanylideneimidazolidin-1-yl]-2,4-dichlorobenzamide (PubChem CID 19584955) has the molecular formula C20H18Cl2N4O3S and a molecular weight of 465.36 g/mol. Its IUPAC name is N-[3-benzyl-5-[2-(methylamino)-2-oxoethyl]-4-oxo-2-sulfanylideneimidazolidin-1-yl]-2,4-dichlorobenzamide.
| Compound Name | N-[3-benzyl-5-[2-(methylamino)-2-oxoethyl]-4-oxo-2-sulfanylideneimidazolidin-1-yl]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 19584955 |
| Molecular Formula | C20H18Cl2N4O3S |
| Molecular Weight | 465.36 g/mol |
| Exact Mass | 464.05 |
| IUPAC Name | N-[3-benzyl-5-[2-(methylamino)-2-oxoethyl]-4-oxo-2-sulfanylideneimidazolidin-1-yl]-2,4-dichlorobenzamide |
| SMILES | CNC(=O)CC1C(=O)N(Cc2ccccc2)C(=S)N1NC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H18Cl2N4O3S/c1-23-17(27)10-16-19(29)25(11-12-5-3-2-4-6-12)20(30)26(16)24-18(28)14-8-7-13(21)9-15(14)22/h2-9,16H,10-11H2,1H3,(H,23,27)(H,24,28) |
| InChIKey | VETPJXQGOJYHFX-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|