C26H21BrN4O5S — CID 5079824
methyl 4-[[2-[3-[(4-bromobenzoyl)amino]-5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-yl]acetyl]amino]benzoate (PubChem CID 5079824) has the molecular formula C26H21BrN4O5S and a molecular weight of 581.45 g/mol. Its IUPAC name is methyl 4-[[2-[3-[(4-bromobenzoyl)amino]-5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-yl]acetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-[3-[(4-bromobenzoyl)amino]-5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 5079824 |
| Molecular Formula | C26H21BrN4O5S |
| Molecular Weight | 581.45 g/mol |
| Exact Mass | 580.04 |
| IUPAC Name | methyl 4-[[2-[3-[(4-bromobenzoyl)amino]-5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-yl]acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)CC2C(=O)N(c3ccccc3)C(=S)N2NC(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C26H21BrN4O5S/c1-36-25(35)17-9-13-19(14-10-17)28-22(32)15-21-24(34)30(20-5-3-2-4-6-20)26(37)31(21)29-23(33)16-7-11-18(27)12-8-16/h2-14,21H,15H2,1H3,(H,28,32)(H,29,33) |
| InChIKey | VVNHNZYSBFWYJZ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|