C20H19BrN4O4S — CID 4609168
4-bromo-N-[3-(4-methoxyphenyl)-5-[2-(methylamino)-2-oxoethyl]-4-oxo-2-sulfanylideneimidazolidin-1-yl]benzamide (PubChem CID 4609168) has the molecular formula C20H19BrN4O4S and a molecular weight of 491.37 g/mol. Its IUPAC name is 4-bromo-N-[3-(4-methoxyphenyl)-5-[2-(methylamino)-2-oxoethyl]-4-oxo-2-sulfanylideneimidazolidin-1-yl]benzamide.
| Compound Name | 4-bromo-N-[3-(4-methoxyphenyl)-5-[2-(methylamino)-2-oxoethyl]-4-oxo-2-sulfanylideneimidazolidin-1-yl]benzamide |
|---|---|
| PubChem CID | 4609168 |
| Molecular Formula | C20H19BrN4O4S |
| Molecular Weight | 491.37 g/mol |
| Exact Mass | 490.03 |
| IUPAC Name | 4-bromo-N-[3-(4-methoxyphenyl)-5-[2-(methylamino)-2-oxoethyl]-4-oxo-2-sulfanylideneimidazolidin-1-yl]benzamide |
| SMILES | CNC(=O)CC1C(=O)N(c2ccc(OC)cc2)C(=S)N1NC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H19BrN4O4S/c1-22-17(26)11-16-19(28)24(14-7-9-15(29-2)10-8-14)20(30)25(16)23-18(27)12-3-5-13(21)6-4-12/h3-10,16H,11H2,1-2H3,(H,22,26)(H,23,27) |
| InChIKey | LQHVLLHEDQJADM-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|