C25H22N4O5S2 — CID 3793120
ethyl 4-[4-(2-anilino-2-oxoethyl)-5-oxo-2-sulfanylidene-3-(thiophene-2-carbonylamino)imidazolidin-1-yl]benzoate (PubChem CID 3793120) has the molecular formula C25H22N4O5S2 and a molecular weight of 522.61 g/mol. Its IUPAC name is ethyl 4-[4-(2-anilino-2-oxoethyl)-5-oxo-2-sulfanylidene-3-(thiophene-2-carbonylamino)imidazolidin-1-yl]benzoate.
| Compound Name | ethyl 4-[4-(2-anilino-2-oxoethyl)-5-oxo-2-sulfanylidene-3-(thiophene-2-carbonylamino)imidazolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 3793120 |
| Molecular Formula | C25H22N4O5S2 |
| Molecular Weight | 522.61 g/mol |
| Exact Mass | 522.10 |
| IUPAC Name | ethyl 4-[4-(2-anilino-2-oxoethyl)-5-oxo-2-sulfanylidene-3-(thiophene-2-carbonylamino)imidazolidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C(CC(=O)Nc3ccccc3)N(NC(=O)c3cccs3)C2=S)cc1 |
| InChI | InChI=1S/C25H22N4O5S2/c1-2-34-24(33)16-10-12-18(13-11-16)28-23(32)19(15-21(30)26-17-7-4-3-5-8-17)29(25(28)35)27-22(31)20-9-6-14-36-20/h3-14,19H,2,15H2,1H3,(H,26,30)(H,27,31) |
| InChIKey | FKLMIEMSUKMQNH-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.61 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|