C28H34N4O6S — CID 3595227
ethyl 4-[4-[2-(4-ethoxyanilino)-2-oxoethyl]-3-(hexanoylamino)-5-oxo-2-sulfanylideneimidazolidin-1-yl]benzoate (PubChem CID 3595227) has the molecular formula C28H34N4O6S and a molecular weight of 554.67 g/mol. Its IUPAC name is ethyl 4-[4-[2-(4-ethoxyanilino)-2-oxoethyl]-3-(hexanoylamino)-5-oxo-2-sulfanylideneimidazolidin-1-yl]benzoate.
| Compound Name | ethyl 4-[4-[2-(4-ethoxyanilino)-2-oxoethyl]-3-(hexanoylamino)-5-oxo-2-sulfanylideneimidazolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 3595227 |
| Molecular Formula | C28H34N4O6S |
| Molecular Weight | 554.67 g/mol |
| Exact Mass | 554.22 |
| IUPAC Name | ethyl 4-[4-[2-(4-ethoxyanilino)-2-oxoethyl]-3-(hexanoylamino)-5-oxo-2-sulfanylideneimidazolidin-1-yl]benzoate |
| SMILES | CCCCCC(=O)NN1C(=S)N(c2ccc(C(=O)OCC)cc2)C(=O)C1CC(=O)Nc1ccc(OCC)cc1 |
| InChI | InChI=1S/C28H34N4O6S/c1-4-7-8-9-24(33)30-32-23(18-25(34)29-20-12-16-22(17-13-20)37-5-2)26(35)31(28(32)39)21-14-10-19(11-15-21)27(36)38-6-3/h10-17,23H,4-9,18H2,1-3H3,(H,29,34)(H,30,33) |
| InChIKey | SKIUXQNSXNLEEZ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.67 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|