C24H18ClFN4O3S — CID 4083143
N-[5-[2-(3-chloroanilino)-2-oxoethyl]-4-oxo-3-phenyl-2-sulfanylideneimidazolidin-1-yl]-3-fluorobenzamide (PubChem CID 4083143) has the molecular formula C24H18ClFN4O3S and a molecular weight of 496.95 g/mol. Its IUPAC name is N-[5-[2-(3-chloroanilino)-2-oxoethyl]-4-oxo-3-phenyl-2-sulfanylideneimidazolidin-1-yl]-3-fluorobenzamide.
| Compound Name | N-[5-[2-(3-chloroanilino)-2-oxoethyl]-4-oxo-3-phenyl-2-sulfanylideneimidazolidin-1-yl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 4083143 |
| Molecular Formula | C24H18ClFN4O3S |
| Molecular Weight | 496.95 g/mol |
| Exact Mass | 496.08 |
| IUPAC Name | N-[5-[2-(3-chloroanilino)-2-oxoethyl]-4-oxo-3-phenyl-2-sulfanylideneimidazolidin-1-yl]-3-fluorobenzamide |
| SMILES | O=C(CC1C(=O)N(c2ccccc2)C(=S)N1NC(=O)c1cccc(F)c1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C24H18ClFN4O3S/c25-16-7-5-9-18(13-16)27-21(31)14-20-23(33)29(19-10-2-1-3-11-19)24(34)30(20)28-22(32)15-6-4-8-17(26)12-15/h1-13,20H,14H2,(H,27,31)(H,28,32) |
| InChIKey | DYESOFWFGXJLTD-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.95 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|