C14H14N2O5S — CID 1247940
ethyl 4-[[2-[(5R)-2,4-dioxo-1,3-thiazolidin-5-yl]acetyl]amino]benzoate (PubChem CID 1247940) has the molecular formula C14H14N2O5S and a molecular weight of 322.34 g/mol. Its IUPAC name is ethyl 4-[[2-[(5R)-2,4-dioxo-1,3-thiazolidin-5-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[(5R)-2,4-dioxo-1,3-thiazolidin-5-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 1247940 |
| Molecular Formula | C14H14N2O5S |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | ethyl 4-[[2-[(5R)-2,4-dioxo-1,3-thiazolidin-5-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C[C@H]2SC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C14H14N2O5S/c1-2-21-13(19)8-3-5-9(6-4-8)15-11(17)7-10-12(18)16-14(20)22-10/h3-6,10H,2,7H2,1H3,(H,15,17)(H,16,18,20)/t10-/m1/s1 |
| InChIKey | CCULWTWZTGCKLB-SNVBAGLBSA-N |
| XLogP | 1.54 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|