C21H19N5O6S — CID 135706997
ethyl 4-[[2-[(2E)-2-[(E)-(4-nitrophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetyl]amino]benzoate (PubChem CID 135706997) has the molecular formula C21H19N5O6S and a molecular weight of 469.48 g/mol. Its IUPAC name is ethyl 4-[[2-[(2E)-2-[(E)-(4-nitrophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[(2E)-2-[(E)-(4-nitrophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 135706997 |
| Molecular Formula | C21H19N5O6S |
| Molecular Weight | 469.48 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | ethyl 4-[[2-[(2E)-2-[(E)-(4-nitrophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CC2S/C(=N/N=C/c3ccc([N+](=O)[O-])cc3)NC2=O)cc1 |
| InChI | InChI=1S/C21H19N5O6S/c1-2-32-20(29)14-5-7-15(8-6-14)23-18(27)11-17-19(28)24-21(33-17)25-22-12-13-3-9-16(10-4-13)26(30)31/h3-10,12,17H,2,11H2,1H3,(H,23,27)(H,24,25,28)/b22-12+ |
| InChIKey | ANKPVBXAGOHZTF-WSDLNYQXSA-N |
| XLogP | 2.72 |
| TPSA | 152.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.48 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|