C24H24N4O4S — CID 135707035
ethyl 4-[[2-[(2E)-2-[(Z)-[(Z)-2-methyl-3-phenylprop-2-enylidene]hydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetyl]amino]benzoate (PubChem CID 135707035) has the molecular formula C24H24N4O4S and a molecular weight of 464.55 g/mol. Its IUPAC name is ethyl 4-[[2-[(2E)-2-[(Z)-[(Z)-2-methyl-3-phenylprop-2-enylidene]hydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[(2E)-2-[(Z)-[(Z)-2-methyl-3-phenylprop-2-enylidene]hydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 135707035 |
| Molecular Formula | C24H24N4O4S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | ethyl 4-[[2-[(2E)-2-[(Z)-[(Z)-2-methyl-3-phenylprop-2-enylidene]hydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CC2S/C(=N/N=C\C(C)=C/c3ccccc3)NC2=O)cc1 |
| InChI | InChI=1S/C24H24N4O4S/c1-3-32-23(31)18-9-11-19(12-10-18)26-21(29)14-20-22(30)27-24(33-20)28-25-15-16(2)13-17-7-5-4-6-8-17/h4-13,15,20H,3,14H2,1-2H3,(H,26,29)(H,27,28,30)/b16-13-,25-15- |
| InChIKey | PLQPKASIHVLNOG-TWQQDWMESA-N |
| XLogP | 3.87 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|