C23H21N5O5S2 — CID 135711822
ethyl 4-[[2-[(2E)-4-oxo-2-[(E)-(2-oxo-3-phenyl-1,3-thiazolidin-4-ylidene)hydrazinylidene]-1,3-thiazolidin-5-yl]acetyl]amino]benzoate (PubChem CID 135711822) has the molecular formula C23H21N5O5S2 and a molecular weight of 511.59 g/mol. Its IUPAC name is ethyl 4-[[2-[(2E)-4-oxo-2-[(E)-(2-oxo-3-phenyl-1,3-thiazolidin-4-ylidene)hydrazinylidene]-1,3-thiazolidin-5-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[(2E)-4-oxo-2-[(E)-(2-oxo-3-phenyl-1,3-thiazolidin-4-ylidene)hydrazinylidene]-1,3-thiazolidin-5-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 135711822 |
| Molecular Formula | C23H21N5O5S2 |
| Molecular Weight | 511.59 g/mol |
| Exact Mass | 511.10 |
| IUPAC Name | ethyl 4-[[2-[(2E)-4-oxo-2-[(E)-(2-oxo-3-phenyl-1,3-thiazolidin-4-ylidene)hydrazinylidene]-1,3-thiazolidin-5-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CC2S/C(=N/N=C3\CSC(=O)N3c3ccccc3)NC2=O)cc1 |
| InChI | InChI=1S/C23H21N5O5S2/c1-2-33-21(31)14-8-10-15(11-9-14)24-19(29)12-17-20(30)25-22(35-17)27-26-18-13-34-23(32)28(18)16-6-4-3-5-7-16/h3-11,17H,2,12-13H2,1H3,(H,24,29)(H,25,27,30)/b26-18+ |
| InChIKey | KULNLLYEAXCSEO-NLRVBDNBSA-N |
| XLogP | 3.47 |
| TPSA | 129.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.59 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|