C21H21FN4O3S — CID 135448091
N-(4-ethoxyphenyl)-2-[2-[1-(4-fluorophenyl)ethylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetamide (PubChem CID 135448091) has the molecular formula C21H21FN4O3S and a molecular weight of 428.49 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-2-[2-[1-(4-fluorophenyl)ethylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(4-ethoxyphenyl)-2-[2-[1-(4-fluorophenyl)ethylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 135448091 |
| Molecular Formula | C21H21FN4O3S |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | N-(4-ethoxyphenyl)-2-[2-[1-(4-fluorophenyl)ethylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetamide |
| SMILES | CCOc1ccc(NC(=O)CC2SC(=NN=C(C)c3ccc(F)cc3)NC2=O)cc1 |
| InChI | InChI=1S/C21H21FN4O3S/c1-3-29-17-10-8-16(9-11-17)23-19(27)12-18-20(28)24-21(30-18)26-25-13(2)14-4-6-15(22)7-5-14/h4-11,18H,3,12H2,1-2H3,(H,23,27)(H,24,26,28) |
| InChIKey | PTZZSEVTBNMFCA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|