C17H21FN4O2S — CID 137231587
2-[(5R)-2-(3,3-dimethylbutan-2-ylidenehydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]-N-(4-fluorophenyl)acetamide (PubChem CID 137231587) has the molecular formula C17H21FN4O2S and a molecular weight of 364.45 g/mol. Its IUPAC name is 2-[(5R)-2-(3,3-dimethylbutan-2-ylidenehydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[(5R)-2-(3,3-dimethylbutan-2-ylidenehydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 137231587 |
| Molecular Formula | C17H21FN4O2S |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 2-[(5R)-2-(3,3-dimethylbutan-2-ylidenehydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]-N-(4-fluorophenyl)acetamide |
| SMILES | CC(=NN=C1NC(=O)[C@@H](CC(=O)Nc2ccc(F)cc2)S1)C(C)(C)C |
| InChI | InChI=1S/C17H21FN4O2S/c1-10(17(2,3)4)21-22-16-20-15(24)13(25-16)9-14(23)19-12-7-5-11(18)6-8-12/h5-8,13H,9H2,1-4H3,(H,19,23)(H,20,22,24)/t13-/m1/s1 |
| InChIKey | YHGUWAFWFMUWME-CYBMUJFWSA-N |
| XLogP | 3.16 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|