C25H29FN4O3S — CID 135957722
2-[(2Z,5R)-2-[(Z)-1-(4-fluorophenyl)ethylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-(4-hexoxyphenyl)acetamide (PubChem CID 135957722) has the molecular formula C25H29FN4O3S and a molecular weight of 484.60 g/mol. Its IUPAC name is 2-[(2Z,5R)-2-[(Z)-1-(4-fluorophenyl)ethylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-(4-hexoxyphenyl)acetamide.
| Compound Name | 2-[(2Z,5R)-2-[(Z)-1-(4-fluorophenyl)ethylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-(4-hexoxyphenyl)acetamide |
|---|---|
| PubChem CID | 135957722 |
| Molecular Formula | C25H29FN4O3S |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | 2-[(2Z,5R)-2-[(Z)-1-(4-fluorophenyl)ethylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-(4-hexoxyphenyl)acetamide |
| SMILES | CCCCCCOc1ccc(NC(=O)C[C@H]2S/C(=N\N=C(\C)c3ccc(F)cc3)NC2=O)cc1 |
| InChI | InChI=1S/C25H29FN4O3S/c1-3-4-5-6-15-33-21-13-11-20(12-14-21)27-23(31)16-22-24(32)28-25(34-22)30-29-17(2)18-7-9-19(26)10-8-18/h7-14,22H,3-6,15-16H2,1-2H3,(H,27,31)(H,28,30,32)/b29-17-/t22-/m1/s1 |
| InChIKey | QNWWCEACVAVLAD-UYNMVUAKSA-N |
| XLogP | 5.13 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|