C22H23FN4O3S — CID 135408487
(2Z)-2-[(Z)-1-(4-fluorophenyl)ethylidenehydrazinylidene]-4-oxo-N-(4-propoxyphenyl)-1,3-thiazinane-6-carboxamide (PubChem CID 135408487) has the molecular formula C22H23FN4O3S and a molecular weight of 442.52 g/mol. Its IUPAC name is (2Z)-2-[(Z)-1-(4-fluorophenyl)ethylidenehydrazinylidene]-4-oxo-N-(4-propoxyphenyl)-1,3-thiazinane-6-carboxamide.
| Compound Name | (2Z)-2-[(Z)-1-(4-fluorophenyl)ethylidenehydrazinylidene]-4-oxo-N-(4-propoxyphenyl)-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 135408487 |
| Molecular Formula | C22H23FN4O3S |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | (2Z)-2-[(Z)-1-(4-fluorophenyl)ethylidenehydrazinylidene]-4-oxo-N-(4-propoxyphenyl)-1,3-thiazinane-6-carboxamide |
| SMILES | CCCOc1ccc(NC(=O)C2CC(=O)N/C(=N/N=C(/C)c3ccc(F)cc3)S2)cc1 |
| InChI | InChI=1S/C22H23FN4O3S/c1-3-12-30-18-10-8-17(9-11-18)24-21(29)19-13-20(28)25-22(31-19)27-26-14(2)15-4-6-16(23)7-5-15/h4-11,19H,3,12-13H2,1-2H3,(H,24,29)(H,25,27,28)/b26-14- |
| InChIKey | NBYPWKPGDMHWHU-WGARJPEWSA-N |
| XLogP | 3.95 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|