C21H22N4O3S — CID 136910669
(2Z)-N-(4-ethoxyphenyl)-4-oxo-2-(1-phenylethylidenehydrazinylidene)-1,3-thiazinane-6-carboxamide (PubChem CID 136910669) has the molecular formula C21H22N4O3S and a molecular weight of 410.50 g/mol. Its IUPAC name is (2Z)-N-(4-ethoxyphenyl)-4-oxo-2-(1-phenylethylidenehydrazinylidene)-1,3-thiazinane-6-carboxamide.
| Compound Name | (2Z)-N-(4-ethoxyphenyl)-4-oxo-2-(1-phenylethylidenehydrazinylidene)-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 136910669 |
| Molecular Formula | C21H22N4O3S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | (2Z)-N-(4-ethoxyphenyl)-4-oxo-2-(1-phenylethylidenehydrazinylidene)-1,3-thiazinane-6-carboxamide |
| SMILES | CCOc1ccc(NC(=O)C2CC(=O)N/C(=N/N=C(C)c3ccccc3)S2)cc1 |
| InChI | InChI=1S/C21H22N4O3S/c1-3-28-17-11-9-16(10-12-17)22-20(27)18-13-19(26)23-21(29-18)25-24-14(2)15-7-5-4-6-8-15/h4-12,18H,3,13H2,1-2H3,(H,22,27)(H,23,25,26) |
| InChIKey | VKDPCIIZLKPHOW-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|