C21H21ClN4O3S — CID 136772704
(2Z,6S)-2-[(Z)-1-(4-chlorophenyl)ethylidenehydrazinylidene]-N-(3-ethoxyphenyl)-4-oxo-1,3-thiazinane-6-carboxamide (PubChem CID 136772704) has the molecular formula C21H21ClN4O3S and a molecular weight of 444.94 g/mol. Its IUPAC name is (2Z,6S)-2-[(Z)-1-(4-chlorophenyl)ethylidenehydrazinylidene]-N-(3-ethoxyphenyl)-4-oxo-1,3-thiazinane-6-carboxamide.
| Compound Name | (2Z,6S)-2-[(Z)-1-(4-chlorophenyl)ethylidenehydrazinylidene]-N-(3-ethoxyphenyl)-4-oxo-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 136772704 |
| Molecular Formula | C21H21ClN4O3S |
| Molecular Weight | 444.94 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | (2Z,6S)-2-[(Z)-1-(4-chlorophenyl)ethylidenehydrazinylidene]-N-(3-ethoxyphenyl)-4-oxo-1,3-thiazinane-6-carboxamide |
| SMILES | CCOc1cccc(NC(=O)[C@@H]2CC(=O)N/C(=N/N=C(/C)c3ccc(Cl)cc3)S2)c1 |
| InChI | InChI=1S/C21H21ClN4O3S/c1-3-29-17-6-4-5-16(11-17)23-20(28)18-12-19(27)24-21(30-18)26-25-13(2)14-7-9-15(22)10-8-14/h4-11,18H,3,12H2,1-2H3,(H,23,28)(H,24,26,27)/b25-13-/t18-/m0/s1 |
| InChIKey | VSXFWRNNVUDVKJ-GQMTYKABSA-N |
| XLogP | 4.08 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.94 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|