C19H16Cl2N4O2S — CID 135441837
N-(4-chlorophenyl)-2-[1-(4-chlorophenyl)ethylidenehydrazinylidene]-4-oxo-1,3-thiazinane-6-carboxamide (PubChem CID 135441837) has the molecular formula C19H16Cl2N4O2S and a molecular weight of 435.34 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[1-(4-chlorophenyl)ethylidenehydrazinylidene]-4-oxo-1,3-thiazinane-6-carboxamide.
| Compound Name | N-(4-chlorophenyl)-2-[1-(4-chlorophenyl)ethylidenehydrazinylidene]-4-oxo-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 135441837 |
| Molecular Formula | C19H16Cl2N4O2S |
| Molecular Weight | 435.34 g/mol |
| Exact Mass | 434.04 |
| IUPAC Name | N-(4-chlorophenyl)-2-[1-(4-chlorophenyl)ethylidenehydrazinylidene]-4-oxo-1,3-thiazinane-6-carboxamide |
| SMILES | CC(=NN=C1NC(=O)CC(C(=O)Nc2ccc(Cl)cc2)S1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H16Cl2N4O2S/c1-11(12-2-4-13(20)5-3-12)24-25-19-23-17(26)10-16(28-19)18(27)22-15-8-6-14(21)7-9-15/h2-9,16H,10H2,1H3,(H,22,27)(H,23,25,26) |
| InChIKey | YOVCXSIMQJJOEO-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.34 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|