C19H18N4O3S — CID 136711412
(2Z,6R)-2-[(Z)-1-(4-hydroxyphenyl)ethylidenehydrazinylidene]-4-oxo-N-phenyl-1,3-thiazinane-6-carboxamide (PubChem CID 136711412) has the molecular formula C19H18N4O3S and a molecular weight of 382.45 g/mol. Its IUPAC name is (2Z,6R)-2-[(Z)-1-(4-hydroxyphenyl)ethylidenehydrazinylidene]-4-oxo-N-phenyl-1,3-thiazinane-6-carboxamide.
| Compound Name | (2Z,6R)-2-[(Z)-1-(4-hydroxyphenyl)ethylidenehydrazinylidene]-4-oxo-N-phenyl-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 136711412 |
| Molecular Formula | C19H18N4O3S |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | (2Z,6R)-2-[(Z)-1-(4-hydroxyphenyl)ethylidenehydrazinylidene]-4-oxo-N-phenyl-1,3-thiazinane-6-carboxamide |
| SMILES | C/C(=N/N=C1/NC(=O)C[C@H](C(=O)Nc2ccccc2)S1)c1ccc(O)cc1 |
| InChI | InChI=1S/C19H18N4O3S/c1-12(13-7-9-15(24)10-8-13)22-23-19-21-17(25)11-16(27-19)18(26)20-14-5-3-2-4-6-14/h2-10,16,24H,11H2,1H3,(H,20,26)(H,21,23,25)/b22-12-/t16-/m1/s1 |
| InChIKey | GQPVDBYXNQQVEL-YSUUHWHMSA-N |
| XLogP | 2.73 |
| TPSA | 103.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|