C21H21FN4O5S — CID 137226816
acetic acid;N-(4-fluorophenyl)-2-[(E)-1-(4-hydroxyphenyl)ethylidenehydrazinylidene]-4-oxo-1,3-thiazinane-6-carboxamide (PubChem CID 137226816) has the molecular formula C21H21FN4O5S and a molecular weight of 460.49 g/mol. Its IUPAC name is acetic acid;N-(4-fluorophenyl)-2-[(E)-1-(4-hydroxyphenyl)ethylidenehydrazinylidene]-4-oxo-1,3-thiazinane-6-carboxamide.
| Compound Name | acetic acid;N-(4-fluorophenyl)-2-[(E)-1-(4-hydroxyphenyl)ethylidenehydrazinylidene]-4-oxo-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 137226816 |
| Molecular Formula | C21H21FN4O5S |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | acetic acid;N-(4-fluorophenyl)-2-[(E)-1-(4-hydroxyphenyl)ethylidenehydrazinylidene]-4-oxo-1,3-thiazinane-6-carboxamide |
| SMILES | C/C(=N\N=C1NC(=O)CC(C(=O)Nc2ccc(F)cc2)S1)c1ccc(O)cc1.CC(=O)O |
| InChI | InChI=1S/C19H17FN4O3S.C2H4O2/c1-11(12-2-8-15(25)9-3-12)23-24-19-22-17(26)10-16(28-19)18(27)21-14-6-4-13(20)5-7-14;1-2(3)4/h2-9,16,25H,10H2,1H3,(H,21,27)(H,22,24,26);1H3,(H,3,4)/b23-11+; |
| InChIKey | ACLYTDDHJAISHR-YDLOHEMZSA-N |
| XLogP | 2.96 |
| TPSA | 140.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|