C19H17Cl2FN4O2S — CID 163326335
(2E)-N-(4-chlorophenyl)-2-[(E)-1-(4-fluorophenyl)ethylidenehydrazinylidene]-4-oxo-1,3-thiazinane-6-carboxamide;hydrochloride (PubChem CID 163326335) has the molecular formula C19H17Cl2FN4O2S and a molecular weight of 455.34 g/mol. Its IUPAC name is (2E)-N-(4-chlorophenyl)-2-[(E)-1-(4-fluorophenyl)ethylidenehydrazinylidene]-4-oxo-1,3-thiazinane-6-carboxamide;hydrochloride.
| Compound Name | (2E)-N-(4-chlorophenyl)-2-[(E)-1-(4-fluorophenyl)ethylidenehydrazinylidene]-4-oxo-1,3-thiazinane-6-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 163326335 |
| Molecular Formula | C19H17Cl2FN4O2S |
| Molecular Weight | 455.34 g/mol |
| Exact Mass | 454.04 |
| IUPAC Name | (2E)-N-(4-chlorophenyl)-2-[(E)-1-(4-fluorophenyl)ethylidenehydrazinylidene]-4-oxo-1,3-thiazinane-6-carboxamide;hydrochloride |
| SMILES | C/C(=N\N=C1/NC(=O)CC(C(=O)Nc2ccc(Cl)cc2)S1)c1ccc(F)cc1.Cl |
| InChI | InChI=1S/C19H16ClFN4O2S.ClH/c1-11(12-2-6-14(21)7-3-12)24-25-19-23-17(26)10-16(28-19)18(27)22-15-8-4-13(20)5-9-15;/h2-9,16H,10H2,1H3,(H,22,27)(H,23,25,26);1H/b24-11+; |
| InChIKey | YDNXXTBCUWHPTE-IQIGYLCLSA-N |
| XLogP | 4.24 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.34 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|