C32H25N3O5S — CID 135853095
[2-oxo-2-(4-phenylphenyl)ethyl] 4-[[2-(4-oxo-2-phenylimino-1,3-thiazolidin-5-yl)acetyl]amino]benzoate (PubChem CID 135853095) has the molecular formula C32H25N3O5S and a molecular weight of 563.64 g/mol. Its IUPAC name is [2-oxo-2-(4-phenylphenyl)ethyl] 4-[[2-(4-oxo-2-phenylimino-1,3-thiazolidin-5-yl)acetyl]amino]benzoate.
| Compound Name | [2-oxo-2-(4-phenylphenyl)ethyl] 4-[[2-(4-oxo-2-phenylimino-1,3-thiazolidin-5-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 135853095 |
| Molecular Formula | C32H25N3O5S |
| Molecular Weight | 563.64 g/mol |
| Exact Mass | 563.15 |
| IUPAC Name | [2-oxo-2-(4-phenylphenyl)ethyl] 4-[[2-(4-oxo-2-phenylimino-1,3-thiazolidin-5-yl)acetyl]amino]benzoate |
| SMILES | O=C(CC1S/C(=N/c2ccccc2)NC1=O)Nc1ccc(C(=O)OCC(=O)c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C32H25N3O5S/c36-27(23-13-11-22(12-14-23)21-7-3-1-4-8-21)20-40-31(39)24-15-17-26(18-16-24)33-29(37)19-28-30(38)35-32(41-28)34-25-9-5-2-6-10-25/h1-18,28H,19-20H2,(H,33,37)(H,34,35,38) |
| InChIKey | YCIXMJUNFCZUCQ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.64 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|