C27H21N3O7S — CID 135609846
[2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 4-[[2-(4-oxo-2-phenylimino-1,3-thiazolidin-5-yl)acetyl]amino]benzoate (PubChem CID 135609846) has the molecular formula C27H21N3O7S and a molecular weight of 531.55 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 4-[[2-(4-oxo-2-phenylimino-1,3-thiazolidin-5-yl)acetyl]amino]benzoate.
| Compound Name | [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 4-[[2-(4-oxo-2-phenylimino-1,3-thiazolidin-5-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 135609846 |
| Molecular Formula | C27H21N3O7S |
| Molecular Weight | 531.55 g/mol |
| Exact Mass | 531.11 |
| IUPAC Name | [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 4-[[2-(4-oxo-2-phenylimino-1,3-thiazolidin-5-yl)acetyl]amino]benzoate |
| SMILES | O=C(CC1S/C(=N/c2ccccc2)NC1=O)Nc1ccc(C(=O)OCC(=O)c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C27H21N3O7S/c31-20(17-8-11-21-22(12-17)37-15-36-21)14-35-26(34)16-6-9-19(10-7-16)28-24(32)13-23-25(33)30-27(38-23)29-18-4-2-1-3-5-18/h1-12,23H,13-15H2,(H,28,32)(H,29,30,33) |
| InChIKey | XVRNTTOVBSVEJD-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 132.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.55 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|