C13H13N5O4S — CID 154777200
N-(1,3-benzodioxol-5-yl)-2-(2-carbamimidoylimino-4-oxo-1,3-thiazolidin-5-yl)acetamide (PubChem CID 154777200) has the molecular formula C13H13N5O4S and a molecular weight of 335.35 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-(2-carbamimidoylimino-4-oxo-1,3-thiazolidin-5-yl)acetamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-(2-carbamimidoylimino-4-oxo-1,3-thiazolidin-5-yl)acetamide |
|---|---|
| PubChem CID | 154777200 |
| Molecular Formula | C13H13N5O4S |
| Molecular Weight | 335.35 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-(2-carbamimidoylimino-4-oxo-1,3-thiazolidin-5-yl)acetamide |
| SMILES | [H]/N=C(\N)N=C1NC(=O)C(CC(=O)Nc2ccc3c(c2)OCO3)S1 |
| InChI | InChI=1S/C13H13N5O4S/c14-12(15)18-13-17-11(20)9(23-13)4-10(19)16-6-1-2-7-8(3-6)22-5-21-7/h1-3,9H,4-5H2,(H,16,19)(H4,14,15,17,18,20) |
| InChIKey | XYIMKWYGLKLQOD-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 138.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.35 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|