C19H16N4O6S — CID 135794860
2-[(5S)-2-(2,3-dihydro-1,4-benzodioxin-6-ylimino)-4-oxo-1,3-thiazolidin-5-yl]-N-(3-nitrophenyl)acetamide (PubChem CID 135794860) has the molecular formula C19H16N4O6S and a molecular weight of 428.43 g/mol. Its IUPAC name is 2-[(5S)-2-(2,3-dihydro-1,4-benzodioxin-6-ylimino)-4-oxo-1,3-thiazolidin-5-yl]-N-(3-nitrophenyl)acetamide.
| Compound Name | 2-[(5S)-2-(2,3-dihydro-1,4-benzodioxin-6-ylimino)-4-oxo-1,3-thiazolidin-5-yl]-N-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 135794860 |
| Molecular Formula | C19H16N4O6S |
| Molecular Weight | 428.43 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | 2-[(5S)-2-(2,3-dihydro-1,4-benzodioxin-6-ylimino)-4-oxo-1,3-thiazolidin-5-yl]-N-(3-nitrophenyl)acetamide |
| SMILES | O=C(C[C@@H]1S/C(=N\c2ccc3c(c2)OCCO3)NC1=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H16N4O6S/c24-17(20-11-2-1-3-13(8-11)23(26)27)10-16-18(25)22-19(30-16)21-12-4-5-14-15(9-12)29-7-6-28-14/h1-5,8-9,16H,6-7,10H2,(H,20,24)(H,21,22,25)/t16-/m0/s1 |
| InChIKey | PAUNPCOZQMFYCZ-INIZCTEOSA-N |
| XLogP | 2.61 |
| TPSA | 132.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.43 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|