C19H18N4O4S — CID 135692139
2-[(5S)-2-(2,6-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(3-nitrophenyl)acetamide (PubChem CID 135692139) has the molecular formula C19H18N4O4S and a molecular weight of 398.44 g/mol. Its IUPAC name is 2-[(5S)-2-(2,6-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(3-nitrophenyl)acetamide.
| Compound Name | 2-[(5S)-2-(2,6-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 135692139 |
| Molecular Formula | C19H18N4O4S |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 2-[(5S)-2-(2,6-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(3-nitrophenyl)acetamide |
| SMILES | Cc1cccc(C)c1/N=C1/NC(=O)[C@H](CC(=O)Nc2cccc([N+](=O)[O-])c2)S1 |
| InChI | InChI=1S/C19H18N4O4S/c1-11-5-3-6-12(2)17(11)21-19-22-18(25)15(28-19)10-16(24)20-13-7-4-8-14(9-13)23(26)27/h3-9,15H,10H2,1-2H3,(H,20,24)(H,21,22,25)/t15-/m0/s1 |
| InChIKey | MZEMPXZKVHROKX-HNNXBMFYSA-N |
| XLogP | 3.46 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|