C11H10N2O5S — CID 142623389
ethyl 1-[(5S)-2,4-dioxo-1,3-thiazolidin-5-yl]-6-oxopyridine-3-carboxylate (PubChem CID 142623389) has the molecular formula C11H10N2O5S and a molecular weight of 282.28 g/mol. Its IUPAC name is ethyl 1-[(5S)-2,4-dioxo-1,3-thiazolidin-5-yl]-6-oxopyridine-3-carboxylate.
| Compound Name | ethyl 1-[(5S)-2,4-dioxo-1,3-thiazolidin-5-yl]-6-oxopyridine-3-carboxylate |
|---|---|
| PubChem CID | 142623389 |
| Molecular Formula | C11H10N2O5S |
| Molecular Weight | 282.28 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | ethyl 1-[(5S)-2,4-dioxo-1,3-thiazolidin-5-yl]-6-oxopyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(=O)n([C@H]2SC(=O)NC2=O)c1 |
| InChI | InChI=1S/C11H10N2O5S/c1-2-18-10(16)6-3-4-7(14)13(5-6)9-8(15)12-11(17)19-9/h3-5,9H,2H2,1H3,(H,12,15,17)/t9-/m0/s1 |
| InChIKey | NTLJSLILDSKRJB-VIFPVBQESA-N |
| XLogP | 0.51 |
| TPSA | 94.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.28 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|