C16H14N4O — CID 58847286
3-(1H-benzimidazol-2-ylmethylamino)-1,3-dihydroindol-2-one (PubChem CID 58847286) has the molecular formula C16H14N4O and a molecular weight of 278.31 g/mol. Its IUPAC name is 3-(1H-benzimidazol-2-ylmethylamino)-1,3-dihydroindol-2-one.
| Compound Name | 3-(1H-benzimidazol-2-ylmethylamino)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 58847286 |
| Molecular Formula | C16H14N4O |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 3-(1H-benzimidazol-2-ylmethylamino)-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2ccccc2C1NCc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C16H14N4O/c21-16-15(10-5-1-2-6-11(10)20-16)17-9-14-18-12-7-3-4-8-13(12)19-14/h1-8,15,17H,9H2,(H,18,19)(H,20,21) |
| InChIKey | LFWBPWSFWCTFCU-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |