C17H14N2O3 — CID 1249039
(3S)-2,4-dioxo-N,1-diphenylpyrrolidine-3-carboxamide (PubChem CID 1249039) has the molecular formula C17H14N2O3 and a molecular weight of 294.31 g/mol. Its IUPAC name is (3S)-2,4-dioxo-N,1-diphenylpyrrolidine-3-carboxamide.
| Compound Name | (3S)-2,4-dioxo-N,1-diphenylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 1249039 |
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | (3S)-2,4-dioxo-N,1-diphenylpyrrolidine-3-carboxamide |
| SMILES | O=C1CN(c2ccccc2)C(=O)[C@@H]1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C17H14N2O3/c20-14-11-19(13-9-5-2-6-10-13)17(22)15(14)16(21)18-12-7-3-1-4-8-12/h1-10,15H,11H2,(H,18,21)/t15-/m0/s1 |
| InChIKey | FFBIEQYGWLQSSR-HNNXBMFYSA-N |
| XLogP | 1.86 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|