C24H22N2O2 — CID 54175267
6,7-dimethyl-4-oxo-N,1-diphenyl-2,3-dihydroquinoline-3-carboxamide (PubChem CID 54175267) has the molecular formula C24H22N2O2 and a molecular weight of 370.45 g/mol. Its IUPAC name is 6,7-dimethyl-4-oxo-N,1-diphenyl-2,3-dihydroquinoline-3-carboxamide.
| Compound Name | 6,7-dimethyl-4-oxo-N,1-diphenyl-2,3-dihydroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 54175267 |
| Molecular Formula | C24H22N2O2 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 6,7-dimethyl-4-oxo-N,1-diphenyl-2,3-dihydroquinoline-3-carboxamide |
| SMILES | Cc1cc2c(cc1C)N(c1ccccc1)CC(C(=O)Nc1ccccc1)C2=O |
| InChI | InChI=1S/C24H22N2O2/c1-16-13-20-22(14-17(16)2)26(19-11-7-4-8-12-19)15-21(23(20)27)24(28)25-18-9-5-3-6-10-18/h3-14,21H,15H2,1-2H3,(H,25,28) |
| InChIKey | OXWCFDPQYWXYDQ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|