C16H15N3O2 — CID 40500966
(3S)-5-oxo-1-phenyl-N-pyridin-4-ylpyrrolidine-3-carboxamide (PubChem CID 40500966) has the molecular formula C16H15N3O2 and a molecular weight of 281.31 g/mol. Its IUPAC name is (3S)-5-oxo-1-phenyl-N-pyridin-4-ylpyrrolidine-3-carboxamide.
| Compound Name | (3S)-5-oxo-1-phenyl-N-pyridin-4-ylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 40500966 |
| Molecular Formula | C16H15N3O2 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | (3S)-5-oxo-1-phenyl-N-pyridin-4-ylpyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1ccncc1)[C@H]1CC(=O)N(c2ccccc2)C1 |
| InChI | InChI=1S/C16H15N3O2/c20-15-10-12(11-19(15)14-4-2-1-3-5-14)16(21)18-13-6-8-17-9-7-13/h1-9,12H,10-11H2,(H,17,18,21)/t12-/m0/s1 |
| InChIKey | XDPGWVBSFAYYJQ-LBPRGKRZSA-N |
| XLogP | 2.07 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |