C18H15N5O3S — CID 5386883
(4Z)-4-(carbamothioylhydrazinylidene)-2,5-dioxo-N,1-diphenylpyrrolidine-3-carboxamide (PubChem CID 5386883) has the molecular formula C18H15N5O3S and a molecular weight of 381.42 g/mol. Its IUPAC name is (4Z)-4-(carbamothioylhydrazinylidene)-2,5-dioxo-N,1-diphenylpyrrolidine-3-carboxamide.
| Compound Name | (4Z)-4-(carbamothioylhydrazinylidene)-2,5-dioxo-N,1-diphenylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 5386883 |
| Molecular Formula | C18H15N5O3S |
| Molecular Weight | 381.42 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | (4Z)-4-(carbamothioylhydrazinylidene)-2,5-dioxo-N,1-diphenylpyrrolidine-3-carboxamide |
| SMILES | NC(=S)N/N=C1\C(=O)N(c2ccccc2)C(=O)C1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C18H15N5O3S/c19-18(27)22-21-14-13(15(24)20-11-7-3-1-4-8-11)16(25)23(17(14)26)12-9-5-2-6-10-12/h1-10,13H,(H,20,24)(H3,19,22,27)/b21-14- |
| InChIKey | JGEBNWSJPYUCEG-STZFKDTASA-N |
| XLogP | 1.00 |
| TPSA | 116.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.42 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|