C19H17N3O4 — CID 98552930
(3R,4E)-4-hydroxyimino-N,1-bis(2-methylphenyl)-2,5-dioxopyrrolidine-3-carboxamide (PubChem CID 98552930) has the molecular formula C19H17N3O4 and a molecular weight of 351.36 g/mol. Its IUPAC name is (3R,4E)-4-hydroxyimino-N,1-bis(2-methylphenyl)-2,5-dioxopyrrolidine-3-carboxamide.
| Compound Name | (3R,4E)-4-hydroxyimino-N,1-bis(2-methylphenyl)-2,5-dioxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 98552930 |
| Molecular Formula | C19H17N3O4 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | (3R,4E)-4-hydroxyimino-N,1-bis(2-methylphenyl)-2,5-dioxopyrrolidine-3-carboxamide |
| SMILES | Cc1ccccc1NC(=O)[C@@H]1C(=O)N(c2ccccc2C)C(=O)/C1=N/O |
| InChI | InChI=1S/C19H17N3O4/c1-11-7-3-5-9-13(11)20-17(23)15-16(21-26)19(25)22(18(15)24)14-10-6-4-8-12(14)2/h3-10,15,26H,1-2H3,(H,20,23)/b21-16+/t15-/m1/s1 |
| InChIKey | AQYPQUIGWBJPNA-JJTVEENBSA-N |
| XLogP | 2.26 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|