C18H17N7O8S2 — CID 98296761
(3R,4E)-4-(carbamoylhydrazinylidene)-2,5-dioxo-N,1-bis(4-sulfamoylphenyl)pyrrolidine-3-carboxamide (PubChem CID 98296761) has the molecular formula C18H17N7O8S2 and a molecular weight of 523.51 g/mol. Its IUPAC name is (3R,4E)-4-(carbamoylhydrazinylidene)-2,5-dioxo-N,1-bis(4-sulfamoylphenyl)pyrrolidine-3-carboxamide.
| Compound Name | (3R,4E)-4-(carbamoylhydrazinylidene)-2,5-dioxo-N,1-bis(4-sulfamoylphenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 98296761 |
| Molecular Formula | C18H17N7O8S2 |
| Molecular Weight | 523.51 g/mol |
| Exact Mass | 523.06 |
| IUPAC Name | (3R,4E)-4-(carbamoylhydrazinylidene)-2,5-dioxo-N,1-bis(4-sulfamoylphenyl)pyrrolidine-3-carboxamide |
| SMILES | NC(=O)N/N=C1/C(=O)N(c2ccc(S(N)(=O)=O)cc2)C(=O)[C@H]1C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C18H17N7O8S2/c19-18(29)24-23-14-13(15(26)22-9-1-5-11(6-2-9)34(20,30)31)16(27)25(17(14)28)10-3-7-12(8-4-10)35(21,32)33/h1-8,13H,(H,22,26)(H3,19,24,29)(H2,20,30,31)(H2,21,32,33)/b23-14+/t13-/m1/s1 |
| InChIKey | ADUZQXRQTUCRDA-DZOGZAPRSA-N |
| XLogP | -1.87 |
| TPSA | 254.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.51 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|