C27H18N6O5S — CID 4848470
N-[4-(1,3-dioxobenzo[de]isoquinolin-2-yl)anilino]-2-oxo-2-(4-sulfamoylanilino)ethanimidoyl cyanide (PubChem CID 4848470) has the molecular formula C27H18N6O5S and a molecular weight of 538.55 g/mol. Its IUPAC name is N-[4-(1,3-dioxobenzo[de]isoquinolin-2-yl)anilino]-2-oxo-2-(4-sulfamoylanilino)ethanimidoyl cyanide.
| Compound Name | N-[4-(1,3-dioxobenzo[de]isoquinolin-2-yl)anilino]-2-oxo-2-(4-sulfamoylanilino)ethanimidoyl cyanide |
|---|---|
| PubChem CID | 4848470 |
| Molecular Formula | C27H18N6O5S |
| Molecular Weight | 538.55 g/mol |
| Exact Mass | 538.11 |
| IUPAC Name | N-[4-(1,3-dioxobenzo[de]isoquinolin-2-yl)anilino]-2-oxo-2-(4-sulfamoylanilino)ethanimidoyl cyanide |
| SMILES | N#CC(=NNc1ccc(N2C(=O)c3cccc4cccc(c34)C2=O)cc1)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C27H18N6O5S/c28-15-23(25(34)30-17-9-13-20(14-10-17)39(29,37)38)32-31-18-7-11-19(12-8-18)33-26(35)21-5-1-3-16-4-2-6-22(24(16)21)27(33)36/h1-14,31H,(H,30,34)(H2,29,37,38) |
| InChIKey | ZJFQEJZYTMKKER-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 174.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.55 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|