C12H16N4O4S2 — CID 6371262
(1E)-1-tert-butylsulfonyl-N-(4-sulfamoylanilino)methanimidoyl cyanide (PubChem CID 6371262) has the molecular formula C12H16N4O4S2 and a molecular weight of 344.42 g/mol. Its IUPAC name is (1E)-1-tert-butylsulfonyl-N-(4-sulfamoylanilino)methanimidoyl cyanide.
| Compound Name | (1E)-1-tert-butylsulfonyl-N-(4-sulfamoylanilino)methanimidoyl cyanide |
|---|---|
| PubChem CID | 6371262 |
| Molecular Formula | C12H16N4O4S2 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | (1E)-1-tert-butylsulfonyl-N-(4-sulfamoylanilino)methanimidoyl cyanide |
| SMILES | CC(C)(C)S(=O)(=O)/C(C#N)=N/Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C12H16N4O4S2/c1-12(2,3)21(17,18)11(8-13)16-15-9-4-6-10(7-5-9)22(14,19)20/h4-7,15H,1-3H3,(H2,14,19,20)/b16-11+ |
| InChIKey | GOZYRNYYGBYTPV-LFIBNONCSA-N |
| XLogP | 0.80 |
| TPSA | 142.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_imine_C(12)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|