C15H15Cl2N3O2S — CID 55355098
4-[(2E)-2-[1-(3,4-dichlorophenyl)propylidene]hydrazinyl]benzenesulfonamide (PubChem CID 55355098) has the molecular formula C15H15Cl2N3O2S and a molecular weight of 372.28 g/mol. Its IUPAC name is 4-[(2E)-2-[1-(3,4-dichlorophenyl)propylidene]hydrazinyl]benzenesulfonamide.
| Compound Name | 4-[(2E)-2-[1-(3,4-dichlorophenyl)propylidene]hydrazinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 55355098 |
| Molecular Formula | C15H15Cl2N3O2S |
| Molecular Weight | 372.28 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | 4-[(2E)-2-[1-(3,4-dichlorophenyl)propylidene]hydrazinyl]benzenesulfonamide |
| SMILES | CC/C(=N\Nc1ccc(S(N)(=O)=O)cc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H15Cl2N3O2S/c1-2-15(10-3-8-13(16)14(17)9-10)20-19-11-4-6-12(7-5-11)23(18,21)22/h3-9,19H,2H2,1H3,(H2,18,21,22)/b20-15+ |
| InChIKey | BVFJMDOKBOLWBU-HMMYKYKNSA-N |
| XLogP | 3.87 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.28 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|