C18H18FN5O3S — CID 142965881
3-[(E)-C-ethyl-N-(4-sulfamoylanilino)carbonimidoyl]-5-fluoro-1H-indole-2-carboxamide (PubChem CID 142965881) has the molecular formula C18H18FN5O3S and a molecular weight of 403.44 g/mol. Its IUPAC name is 3-[(E)-C-ethyl-N-(4-sulfamoylanilino)carbonimidoyl]-5-fluoro-1H-indole-2-carboxamide.
| Compound Name | 3-[(E)-C-ethyl-N-(4-sulfamoylanilino)carbonimidoyl]-5-fluoro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 142965881 |
| Molecular Formula | C18H18FN5O3S |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 3-[(E)-C-ethyl-N-(4-sulfamoylanilino)carbonimidoyl]-5-fluoro-1H-indole-2-carboxamide |
| SMILES | CC/C(=N\Nc1ccc(S(N)(=O)=O)cc1)c1c(C(N)=O)[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C18H18FN5O3S/c1-2-14(24-23-11-4-6-12(7-5-11)28(21,26)27)16-13-9-10(19)3-8-15(13)22-17(16)18(20)25/h3-9,22-23H,2H2,1H3,(H2,20,25)(H2,21,26,27)/b24-14+ |
| InChIKey | WDSUVUPKUIYONK-ZVHZXABRSA-N |
| XLogP | 2.28 |
| TPSA | 143.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|