C17H21ClN4O2S — CID 124926686
4-[(2Z)-2-[1-(4-chlorophenyl)-3-(dimethylamino)propylidene]hydrazinyl]benzenesulfonamide (PubChem CID 124926686) has the molecular formula C17H21ClN4O2S and a molecular weight of 380.90 g/mol. Its IUPAC name is 4-[(2Z)-2-[1-(4-chlorophenyl)-3-(dimethylamino)propylidene]hydrazinyl]benzenesulfonamide.
| Compound Name | 4-[(2Z)-2-[1-(4-chlorophenyl)-3-(dimethylamino)propylidene]hydrazinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 124926686 |
| Molecular Formula | C17H21ClN4O2S |
| Molecular Weight | 380.90 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 4-[(2Z)-2-[1-(4-chlorophenyl)-3-(dimethylamino)propylidene]hydrazinyl]benzenesulfonamide |
| SMILES | CN(C)CC/C(=N/Nc1ccc(S(N)(=O)=O)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H21ClN4O2S/c1-22(2)12-11-17(13-3-5-14(18)6-4-13)21-20-15-7-9-16(10-8-15)25(19,23)24/h3-10,20H,11-12H2,1-2H3,(H2,19,23,24)/b21-17- |
| InChIKey | KRNSNCABULNGSO-FXBPSFAMSA-N |
| XLogP | 2.76 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.90 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|