C16H25N3O2S — CID 3657005
4-[2-(4-tert-butylcyclohexylidene)hydrazinyl]benzenesulfonamide (PubChem CID 3657005) has the molecular formula C16H25N3O2S and a molecular weight of 323.46 g/mol. Its IUPAC name is 4-[2-(4-tert-butylcyclohexylidene)hydrazinyl]benzenesulfonamide.
| Compound Name | 4-[2-(4-tert-butylcyclohexylidene)hydrazinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 3657005 |
| Molecular Formula | C16H25N3O2S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 4-[2-(4-tert-butylcyclohexylidene)hydrazinyl]benzenesulfonamide |
| SMILES | CC(C)(C)C1CCC(=NNc2ccc(S(N)(=O)=O)cc2)CC1 |
| InChI | InChI=1S/C16H25N3O2S/c1-16(2,3)12-4-6-13(7-5-12)18-19-14-8-10-15(11-9-14)22(17,20)21/h8-12,19H,4-7H2,1-3H3,(H2,17,20,21)/b18-13- |
| InChIKey | MLFUJHNRRADLBB-AQTBWJFISA-N |
| XLogP | 3.34 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|