C15H21N3O4S — CID 7689704
methyl 2-[(1S,2Z)-2-[(4-sulfamoylphenyl)hydrazinylidene]cyclohexyl]acetate (PubChem CID 7689704) has the molecular formula C15H21N3O4S and a molecular weight of 339.42 g/mol. Its IUPAC name is methyl 2-[(1S,2Z)-2-[(4-sulfamoylphenyl)hydrazinylidene]cyclohexyl]acetate.
| Compound Name | methyl 2-[(1S,2Z)-2-[(4-sulfamoylphenyl)hydrazinylidene]cyclohexyl]acetate |
|---|---|
| PubChem CID | 7689704 |
| Molecular Formula | C15H21N3O4S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | methyl 2-[(1S,2Z)-2-[(4-sulfamoylphenyl)hydrazinylidene]cyclohexyl]acetate |
| SMILES | COC(=O)C[C@@H]1CCCC/C1=N/Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C15H21N3O4S/c1-22-15(19)10-11-4-2-3-5-14(11)18-17-12-6-8-13(9-7-12)23(16,20)21/h6-9,11,17H,2-5,10H2,1H3,(H2,16,20,21)/b18-14-/t11-/m0/s1 |
| InChIKey | KVQIBOZWPOTKOO-WMEZLHQCSA-N |
| XLogP | 1.86 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|